CAS 675602-95-6 is the registry number for 4-(4-Methyl-3-nitrophenyl)-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-amine (CAS 675602-95-6) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: 4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-amine. InChIKey: GVEJZEYQGIOTNB-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 4-(4-methyl-3-nitrophenyl)-1,3-thiazol-2-amine |
| InChIKey | GVEJZEYQGIOTNB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CSC(=N2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)