CAS 51550-40-4 appears in our catalog under these names: N’-(2,4-Dimethylphenyl)-N-methylformamide Hydrochloride, >95% (HPLC), N'-(2,4-Dimethylphenyl)-N-methylformamide Hydrochloride, >95% (HPLC), N'-(2,4-Dimethylphenyl)-N-methylformamide hydrochloride, N-2,4-Dimethylphenyl-N'-methylformamidine HCl, Concentration: 100 µg/ml Solvent: Acetonitrile, N-2,4-Dimethylphenyl-N'-methylformamidine HCl, Concentration: 10.0 µg/ml Solvent: Acetonitrile. Offered by: TRC, Biosynth, HPC Standards. Available pack sizes: 100mg, 25mg, 50mg, 75mg, 1x1ml, 1x10ml, 1x10mg.
N-(2,4-dimethylphenyl)-N'-methylmethanimidamide;hydrochloride (CAS 51550-40-4) is a chemical compound with the molecular formula C10H15ClN2 and a molecular weight of 198.69 g/mol. IUPAC name: N-(2,4-dimethylphenyl)-N'-methylmethanimidamide;hydrochloride. InChIKey: VXSNJXDZTGFDMB-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2 |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)-N'-methylmethanimidamide;hydrochloride |
| InChIKey | VXSNJXDZTGFDMB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC=NC)C.Cl |
Computed by PubChem (NCBI)