Products 51579-87-4
CAS 51579-87-4 is the registry number for N,N-Dimethyl-α-oxobenzeneacetamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N,N-dimethyl-2-oxo-2-phenylacetamide (CAS 51579-87-4) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: N,N-dimethyl-2-oxo-2-phenylacetamide. InChIKey: LLYZVJBEERUMBM-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | N,N-dimethyl-2-oxo-2-phenylacetamide |
| InChIKey | LLYZVJBEERUMBM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)