Products 515832-69-6
CAS 515832-69-6 is the registry number for 2-(4-Bromo-2-formylphenoxy)acetamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(4-bromo-2-formylphenoxy)acetamide (CAS 515832-69-6) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 2-(4-bromo-2-formylphenoxy)acetamide. InChIKey: FGODYUATYQJXFU-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 2-(4-bromo-2-formylphenoxy)acetamide |
| InChIKey | FGODYUATYQJXFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C=O)OCC(=O)N |
Computed by PubChem (NCBI)