CAS 51617-12-0 appears in our catalog under these names: 4-Amino-2,8-dimethylquinoline, 95%, 2,8-Dimethylquinolin-4-amine, 95+%, 4-Amino-2,8-dimethylquinoline, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.
2,8-dimethylquinolin-4-amine (CAS 51617-12-0) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 2,8-dimethylquinolin-4-amine. InChIKey: KKAHYNSPPVCKKU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 2,8-dimethylquinolin-4-amine |
| InChIKey | KKAHYNSPPVCKKU-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)C)N |
Computed by PubChem (NCBI)