Products 51656-68-9
CAS 51656-68-9 appears in our catalog under these names: 3–(2，6–Dichlorophenyl)propanoic acid, 3-(2,6-Dichlorophenyl)propionic acid, 96% , 3-(2,6-Dichlorophenyl)propanoic acid 98%, 3-(2,6-Dichlorophenyl)propionic acid, 97%, 97%, 3-(2,6-Dichlorophenyl)propionic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg, 10g.
3-(2,6-dichlorophenyl)propanoic acid (CAS 51656-68-9) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 3-(2,6-dichlorophenyl)propanoic acid. InChIKey: IDEOVPXKPDUXTP-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 3-(2,6-dichlorophenyl)propanoic acid |
| InChIKey | IDEOVPXKPDUXTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CCC(=O)O)Cl |
Computed by PubChem (NCBI)