CAS 51726-39-7 appears in our catalog under these names: 6-Methyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95%, 6-Methyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
6-methyl-4-oxo-1H-quinoline-3-carboxylic acid (CAS 51726-39-7) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 6-methyl-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: MBHYBSDKDMRZAA-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 6-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | MBHYBSDKDMRZAA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)