Products 51758-97-5
CAS 51758-97-5 appears in our catalog under these names: 2-Cyclopropyl-5-nitro-1H-1,3-benzodiazole, 2-Cyclopropyl-5-nitro-1H-1,3-benzodiazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 10g.
2-cyclopropyl-6-nitro-1H-benzimidazole (CAS 51758-97-5) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 2-cyclopropyl-6-nitro-1H-benzimidazole. InChIKey: QKWXLTTXVGJHOZ-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 2-cyclopropyl-6-nitro-1H-benzimidazole |
| InChIKey | QKWXLTTXVGJHOZ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(N2)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)