CAS 5177-39-9 appears in our catalog under these names: 7–Chloro–2,3,4,5–tetrahydro–1H–1,4–benzodiazepine–2,5–dione, 7-Chloro-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine-2,5-dione, 95%, 95%, 7-Chloro-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
7-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (CAS 5177-39-9) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 7-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione. InChIKey: DUAONSMGNHXBMX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 7-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| InChIKey | DUAONSMGNHXBMX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Cl)C(=O)N1 |
Computed by PubChem (NCBI)