CAS 5181-35-1 appears in our catalog under these names: N-(2-Bromoethoxy)phthalimide, 2–(2–Bromoethoxy)isoindoline–1,3–dione, 2-(2-Bromoethoxy)isoindoline-1,3-dione 95%, 2-(2-Bromoethoxy)isoindoline-1,3-dione, 95%, 95%, 2-(2-Bromoethoxy)isoindoline-1,3-dione, 95%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 1000mg, 25g, 5g.
2-(2-bromoethoxy)isoindole-1,3-dione (CAS 5181-35-1) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: 2-(2-bromoethoxy)isoindole-1,3-dione. InChIKey: OCWDBKQNNKCYCJ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 2-(2-bromoethoxy)isoindole-1,3-dione |
| InChIKey | OCWDBKQNNKCYCJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCCBr |
Computed by PubChem (NCBI)