CAS 51885-86-0 appears in our catalog under these names: Methyl 4-methanesulfinylbenzoate, 95%, Methyl 4-methanesulfinylbenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 4-methylsulfinylbenzoate (CAS 51885-86-0) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: methyl 4-methylsulfinylbenzoate. InChIKey: DZWCSSHXJQPVSW-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | methyl 4-methylsulfinylbenzoate |
| InChIKey | DZWCSSHXJQPVSW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)S(=O)C |
Computed by PubChem (NCBI)