CAS 519-66-4 appears in our catalog under these names: Repirinast Impurity 1, 4-Hydroxy-1-methyl-3-phenylquinolin-2(1H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-1-methyl-3-phenylquinolin-2-one (CAS 519-66-4) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 4-hydroxy-1-methyl-3-phenylquinolin-2-one. InChIKey: CLKIYIWKKBDFBS-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 4-hydroxy-1-methyl-3-phenylquinolin-2-one |
| InChIKey | CLKIYIWKKBDFBS-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=C(C1=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)