CAS 519019-53-5 is the registry number for 2-(Oxolan-2-yl)-1H-1,3-benzodiazol-5-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(oxolan-2-yl)-3H-benzimidazol-5-amine (CAS 519019-53-5) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 2-(oxolan-2-yl)-3H-benzimidazol-5-amine. InChIKey: WWXLYTYBWPHCQF-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-(oxolan-2-yl)-3H-benzimidazol-5-amine |
| InChIKey | WWXLYTYBWPHCQF-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=NC3=C(N2)C=C(C=C3)N |
Computed by PubChem (NCBI)