CAS 520-29-6 is the registry number for (RS)-Sakuranetin. Offered by: MedChemExpress. Available pack sizes: 1 mg, 25 mg, 10 mg, 5 mg.
5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one (CAS 520-29-6) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one. InChIKey: DJOJDHGQRNZXQQ-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | DJOJDHGQRNZXQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)