CAS 52177-75-0 is the registry number for 4-(Benzyloxy)phenyl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-phenylmethoxyphenyl) carbonochloridate (CAS 52177-75-0) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: (4-phenylmethoxyphenyl) carbonochloridate. InChIKey: AJGFKMWQFMDKTJ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | (4-phenylmethoxyphenyl) carbonochloridate |
| InChIKey | AJGFKMWQFMDKTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)OC(=O)Cl |
Computed by PubChem (NCBI)