Products 52177-75-0

CAS 52177-75-0 is the registry number for 4-(Benzyloxy)phenyl carbonochloridate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4-phenylmethoxyphenyl) carbonochloridate (CAS 52177-75-0) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: (4-phenylmethoxyphenyl) carbonochloridate. InChIKey: AJGFKMWQFMDKTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO3
Molecular weight262.69 g/mol
IUPAC name(4-phenylmethoxyphenyl) carbonochloridate
InChIKeyAJGFKMWQFMDKTJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=C(C=C2)OC(=O)Cl

Computed by PubChem (NCBI)