Products 521983-07-3
CAS 521983-07-3 appears in our catalog under these names: 4-Chloro-3-(oxazol-5-yl)aniline, 98%, 4-Chloro-3-(1,3-oxazol-5-yl)aniline, 96%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-chloro-3-(1,3-oxazol-5-yl)aniline (CAS 521983-07-3) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 4-chloro-3-(1,3-oxazol-5-yl)aniline. InChIKey: KQODRCWCBWVUQX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 4-chloro-3-(1,3-oxazol-5-yl)aniline |
| InChIKey | KQODRCWCBWVUQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C2=CN=CO2)Cl |
Computed by PubChem (NCBI)