CAS 522634-31-7 appears in our catalog under these names: 1-(4-(Trifluoromethyl)phenyl)-1H-1,2,4-triazol-3-ol, 95%, 1-(4-(Trifluoromethyl)phenyl)-1H-1,2,4-triazol-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one (CAS 522634-31-7) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one. InChIKey: OUGYZOFPWJPXLA-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-5-one |
| InChIKey | OUGYZOFPWJPXLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)N2C=NC(=O)N2 |
Computed by PubChem (NCBI)