Products 52311-42-9
CAS 52311-42-9 appears in our catalog under these names: [4,4'-Bipyridin]-2-amine, 97%, [4,4'-bipyridin]-2-amine, 98%, 98%, 4,4'-Bipyridin-2-amine, 98%, [4,4'-Bipyridin]-2-amine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-pyridin-4-ylpyridin-2-amine (CAS 52311-42-9) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 4-pyridin-4-ylpyridin-2-amine. InChIKey: CJNIYDONPNBZEZ-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 4-pyridin-4-ylpyridin-2-amine |
| InChIKey | CJNIYDONPNBZEZ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC(=NC=C2)N |
Computed by PubChem (NCBI)