Products 52358-58-4
CAS 52358-58-4 is the registry number for Erysotramidine. Offered by: Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg.
(2R,13bS)-2,11,12-trimethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one (CAS 52358-58-4) is a chemical compound with the molecular formula C19H21NO4 and a molecular weight of 327.4 g/mol. IUPAC name: (2R,13bS)-2,11,12-trimethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one. InChIKey: AUDDBHVKKYSXKU-LIRRHRJNSA-N.
| Molecular formula | C19H21NO4 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (2R,13bS)-2,11,12-trimethoxy-1,2,8,9-tetrahydroindolo[7a,1-a]isoquinolin-6-one |
| InChIKey | AUDDBHVKKYSXKU-LIRRHRJNSA-N |
| SMILES | CO[C@@H]1C[C@@]23C(=CC(=O)N2CCC4=CC(=C(C=C34)OC)OC)C=C1 |
Computed by PubChem (NCBI)