CAS 5241-56-5 appears in our catalog under these names: (R)-Benzyl (1-amino-1-oxo-3-phenylpropan-2-yl)carbamate, 97%, (R)–Benzyl (1–amino–1–oxo–3–phenylpropan–2–yl)carbamate, Cbz-D-Phe-NH2 97%. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
Benzyl N-[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 5241-56-5) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: benzyl N-[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: HHBOFAIEPRHUSR-OAHLLOKOSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | benzyl N-[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | HHBOFAIEPRHUSR-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)N)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)