CAS 52415-10-8 is the registry number for 3-Bromo-6-nitrodurene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-2,3,5,6-tetramethyl-4-nitrobenzene (CAS 52415-10-8) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 1-bromo-2,3,5,6-tetramethyl-4-nitrobenzene. InChIKey: ZKJBOKTVENHJJA-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 1-bromo-2,3,5,6-tetramethyl-4-nitrobenzene |
| InChIKey | ZKJBOKTVENHJJA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1[N+](=O)[O-])C)C)Br)C |
Computed by PubChem (NCBI)