CAS 52427-06-2 appears in our catalog under these names: 2-(2-Chloro-5-nitrophenoxy)acetic acid, 98%, 2-(2-Chloro-5-nitrophenoxy)acetic acid, 97%, 2-(2-Chloro-5-nitrophenoxy)acetic acid, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g, 2.5g.
2-(2-chloro-5-nitrophenoxy)acetic acid (CAS 52427-06-2) is a chemical compound with the molecular formula C8H6ClNO5 and a molecular weight of 231.59 g/mol. IUPAC name: 2-(2-chloro-5-nitrophenoxy)acetic acid. InChIKey: DGQMSDQVQRPTCY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO5 |
|---|---|
| Molecular weight | 231.59 g/mol |
| IUPAC name | 2-(2-chloro-5-nitrophenoxy)acetic acid |
| InChIKey | DGQMSDQVQRPTCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])OCC(=O)O)Cl |
Computed by PubChem (NCBI)