Products 524726-20-3
CAS 524726-20-3 is the registry number for 8-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
8-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine (CAS 524726-20-3) is a chemical compound with the molecular formula C14H11N3O2 and a molecular weight of 253.26 g/mol. IUPAC name: 8-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine. InChIKey: XEHFGVSJJRRHAB-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 8-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridine |
| InChIKey | XEHFGVSJJRRHAB-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)