CAS 52514-63-3 appears in our catalog under these names: Carbidopa EP Impurity E, (S)-Carbidopa Methyl Ester (>90%), Methyl (2S)-3-(3,4-Dihydroxyphenyl)-2-hydrazino-2-methylpropanoate (Carbidopa Methyl Ester), Carbidopa Methyl Ester, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, Chemat. Available pack sizes: on request, 100mg, 10mg, 25mg.
Methyl (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate (CAS 52514-63-3) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: methyl (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate. InChIKey: IETYBXLXKYRFEN-NSHDSACASA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | methyl (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate |
| InChIKey | IETYBXLXKYRFEN-NSHDSACASA-N |
| SMILES | C[C@](CC1=CC(=C(C=C1)O)O)(C(=O)OC)NN |
Computed by PubChem (NCBI)