Products 5252-47-1
CAS 5252-47-1 appears in our catalog under these names: 2，3–dihydropyrano(3，2–f)quinolin–1–one, 2,3-Dihydro-1h-pyrano[3,2-f]quinolin-1-one, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2,3-dihydropyrano[3,2-f]quinolin-1-one (CAS 5252-47-1) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 2,3-dihydropyrano[3,2-f]quinolin-1-one. InChIKey: WCHUCTUXZYNJKJ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2,3-dihydropyrano[3,2-f]quinolin-1-one |
| InChIKey | WCHUCTUXZYNJKJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)