CAS 52535-61-2 is the registry number for Ethyl 5–methoxy–1,2–dimethyl–4–nitroindole–3–carboxylate. Offered by: GLPBio. Available pack sizes: 200mg.
Ethyl 5-methoxy-1,2-dimethyl-4-nitroindole-3-carboxylate (CAS 52535-61-2) is a chemical compound with the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. IUPAC name: ethyl 5-methoxy-1,2-dimethyl-4-nitroindole-3-carboxylate. InChIKey: GHHHFEFZDYXZFT-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | ethyl 5-methoxy-1,2-dimethyl-4-nitroindole-3-carboxylate |
| InChIKey | GHHHFEFZDYXZFT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=C1C(=C(C=C2)OC)[N+](=O)[O-])C)C |
Computed by PubChem (NCBI)