Products 52549-44-7
CAS 52549-44-7 appears in our catalog under these names: Pranoprofen N-Oxide, Pranoprofen Impurity 25, Pranoprofen Impurity 19. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(1-oxido-5H-chromeno[2,3-b]pyridin-1-ium-7-yl)propanoic acid (CAS 52549-44-7) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 2-(1-oxido-5H-chromeno[2,3-b]pyridin-1-ium-7-yl)propanoic acid. InChIKey: SRDVEHWJQATWNL-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 2-(1-oxido-5H-chromeno[2,3-b]pyridin-1-ium-7-yl)propanoic acid |
| InChIKey | SRDVEHWJQATWNL-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)OC3=C(C2)C=CC=[N+]3[O-])C(=O)O |
Computed by PubChem (NCBI)