CAS 52558-24-4 appears in our catalog under these names: Boc-IsoSer-OH 98%, (S)-3-((tert-Butoxycarbonyl)amino)-2-hydroxypropanoic acid, 98%, 98%, (S)-3-((tert-Butoxycarbonyl)amino)-2-hydroxypropanoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g.
(2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 52558-24-4) is a chemical compound with the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. IUPAC name: (2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JJCAYTVAYSGVLA-YFKPBYRVSA-N.
| Molecular formula | C8H15NO5 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (2S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JJCAYTVAYSGVLA-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)