CAS 525587-92-2 is the registry number for N-Carbobenzoxyglycine-13C2,15N. Offered by: TRC. Available pack sizes: 100mg, 1g.
2-(phenylmethoxycarbonyl(15N)amino)acetic acid (CAS 525587-92-2) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 212.18 g/mol. IUPAC name: 2-(phenylmethoxycarbonyl(15N)amino)acetic acid. InChIKey: CJUMAFVKTCBCJK-DYYXCFAWSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 212.18 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonyl(15N)amino)acetic acid |
| InChIKey | CJUMAFVKTCBCJK-DYYXCFAWSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[15NH][13CH2][13C](=O)O |
Computed by PubChem (NCBI)