CAS 953410-73-6 is the registry number for (R)-2-(3,6-Dioxopiperazin-2-yl)acetic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-[(2R)-3,6-dioxopiperazin-2-yl]acetic acid (CAS 953410-73-6) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: 2-[(2R)-3,6-dioxopiperazin-2-yl]acetic acid. InChIKey: STTIAONCINEOLF-GSVOUGTGSA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 2-[(2R)-3,6-dioxopiperazin-2-yl]acetic acid |
| InChIKey | STTIAONCINEOLF-GSVOUGTGSA-N |
| SMILES | C1C(=O)N[C@@H](C(=O)N1)CC(=O)O |
Computed by PubChem (NCBI)