Products 5267-34-5
CAS 5267-34-5 appears in our catalog under these names: Benzhydrylamine Hydrochloride, Benzhydrylamine Hydrochloride, >98.0%(HPLC)(T), Benzhydrylamine hydrochloride, 97%, 97%, Benzhydrylamine Hydrochloride, 95%, Benzhydrylamine hydrochloride 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 250g, 500g, 50g, 25g, 5g, 10g, 1kg.
Diphenylmethanamine;hydrochloride (CAS 5267-34-5) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: diphenylmethanamine;hydrochloride. InChIKey: CIHWJRSPVJBHGT-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | diphenylmethanamine;hydrochloride |
| InChIKey | CIHWJRSPVJBHGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Benzhydrylammonium chloride, Benzenemethanamine, alpha-phenyl-, hydrochloride, Benzenemethanamine, .alpha.-phenyl-, hydrochloride, Benzhydrylamine hydrochloride, Aminodiphenylmethane hydrochloride, diphenylmethanamine hydrochloride, diphenylmethanamine;hydrochloride, 1,1-Diphenylmethylamine hydrochloride, diphenylmethylamine, chloride, Benzhydrylaminehydrochloride