CAS 52751-46-9 is the registry number for 3-Acetyl-7-hydroxy-2-methyl-4H-chromen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-acetyl-7-hydroxy-2-methylchromen-4-one (CAS 52751-46-9) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 3-acetyl-7-hydroxy-2-methylchromen-4-one. InChIKey: YDCGCYPZSJJCKP-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 3-acetyl-7-hydroxy-2-methylchromen-4-one |
| InChIKey | YDCGCYPZSJJCKP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(O1)C=C(C=C2)O)C(=O)C |
Computed by PubChem (NCBI)