CAS 52811-31-1 appears in our catalog under these names: (–)–Dalbergiphenol, (-)-Dalbergiphenol, (7S)-Dalbergiphenol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
2,4-dimethoxy-5-[(1S)-1-phenylprop-2-enyl]phenol (CAS 52811-31-1) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 2,4-dimethoxy-5-[(1S)-1-phenylprop-2-enyl]phenol. InChIKey: SLLCQEPKLKMZKP-ZDUSSCGKSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 2,4-dimethoxy-5-[(1S)-1-phenylprop-2-enyl]phenol |
| InChIKey | SLLCQEPKLKMZKP-ZDUSSCGKSA-N |
| SMILES | COC1=CC(=C(C=C1[C@@H](C=C)C2=CC=CC=C2)O)OC |
Computed by PubChem (NCBI)