CAS 5285-18-7 appears in our catalog under these names: 5-(Benzo[d][1,3]dioxol-5-yl)penta-2,4-dienoic acid, 97%, 5-(1,3-BENZODIOXOL-5-YL)-2,4-PENTADIENO&. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 1G.
5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid (CAS 5285-18-7) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid. InChIKey: RHBGITBPARBDPH-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoic acid |
| InChIKey | RHBGITBPARBDPH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C=CC=CC(=O)O |
Computed by PubChem (NCBI)