CAS 52927-22-7 appears in our catalog under these names: 6-Cyano-2-naphthol, >95% (HPLC), 6–Cyano–2–naphthol, 6-Hydroxy-2-naphthonitrile, >98.0%(GC)(T), 6-Hydroxy-2-naphthonitrile 97%, 6-CYANO-2-NAPHTHOL, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 50g.
6-hydroxynaphthalene-2-carbonitrile (CAS 52927-22-7) is a chemical compound with the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. IUPAC name: 6-hydroxynaphthalene-2-carbonitrile. InChIKey: WKTNIBWKHNIPQR-UHFFFAOYSA-N.
| Molecular formula | C11H7NO |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 6-hydroxynaphthalene-2-carbonitrile |
| InChIKey | WKTNIBWKHNIPQR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C=C1C#N |
Computed by PubChem (NCBI)