CAS 53001-68-6 is the registry number for Methyl 2,3,4,6-tetrafluorobenzoate. Offered by: TRC. Available pack sizes: 2,5g.
Methyl 2,3,4,6-tetrafluorobenzoate (CAS 53001-68-6) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: methyl 2,3,4,6-tetrafluorobenzoate. InChIKey: PXXRNDMEWYJEDI-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | methyl 2,3,4,6-tetrafluorobenzoate |
| InChIKey | PXXRNDMEWYJEDI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1F)F)F)F |
Computed by PubChem (NCBI)