CAS 531-02-2 is the registry number for Phloroglucinol Impurity 51. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,5-dihydroxyphenyl)benzene-1,3-diol (CAS 531-02-2) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 5-(3,5-dihydroxyphenyl)benzene-1,3-diol. InChIKey: VZLUGGCFYPMLMI-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 5-(3,5-dihydroxyphenyl)benzene-1,3-diol |
| InChIKey | VZLUGGCFYPMLMI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)O)C2=CC(=CC(=C2)O)O |
Computed by PubChem (NCBI)