CAS 5328-80-3 appears in our catalog under these names: Benzaldehyde,2-chloro-, 2-[(2-chlorophenyl)methylene]hydrazone, 97%, 97%, 2-Chlorobenzaldehyde azine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(E)-1-(2-chlorophenyl)-N-[(E)-(2-chlorophenyl)methylideneamino]methanimine (CAS 5328-80-3) is a chemical compound with the molecular formula C14H10Cl2N2 and a molecular weight of 277.1 g/mol. IUPAC name: (E)-1-(2-chlorophenyl)-N-[(E)-(2-chlorophenyl)methylideneamino]methanimine. InChIKey: WQRRWZFEJAGOIY-BEQMOXJMSA-N.
| Molecular formula | C14H10Cl2N2 |
|---|---|
| Molecular weight | 277.1 g/mol |
| IUPAC name | (E)-1-(2-chlorophenyl)-N-[(E)-(2-chlorophenyl)methylideneamino]methanimine |
| InChIKey | WQRRWZFEJAGOIY-BEQMOXJMSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/N=C/C2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)