Products 53312-92-8
CAS 53312-92-8 appears in our catalog under these names: N-(2-Chloro-5-cyanophenyl)acetamide, 95%, N-(5-Cyano-2-chlorophenyl)acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg.
N-(2-chloro-5-cyanophenyl)acetamide (CAS 53312-92-8) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: N-(2-chloro-5-cyanophenyl)acetamide. InChIKey: RKUWJKAWLIGQGL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | N-(2-chloro-5-cyanophenyl)acetamide |
| InChIKey | RKUWJKAWLIGQGL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)C#N)Cl |
Computed by PubChem (NCBI)