CAS 53317-22-9 appears in our catalog under these names: 3-(Benzyloxy)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid, 96%, N–Boc–O–benzyl–DL–serine, Boc-DL-Ser(Bzl)-OH 95%, 3-(Benzyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid, 95%, 95%, 3-(benzyloxy)-2-{[(tert-butoxy)carbonyl]amino}propanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoic acid (CAS 53317-22-9) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoic acid. InChIKey: DMBKPDOAQVGTST-UHFFFAOYSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylmethoxypropanoic acid |
| InChIKey | DMBKPDOAQVGTST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(COCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)