CAS 53324-38-2 appears in our catalog under these names: 4-Bromo-3-nitroaniline, 97%, 4–Bromo–3–nitroaniline, 4-Bromo-3-nitroaniline, >98.0%(GC), 4-Bromo-3-nitroaniline, 4-Bromo-3-nitroaniline 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Thermo Scientific (Acros). Available pack sizes: 25g, 100g, 5g, 1g, 10g, 0,25kg, 0,1kg, 0,5kg.
4-bromo-3-nitroaniline (CAS 53324-38-2) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 4-bromo-3-nitroaniline. InChIKey: PITHQPMZWKZGRZ-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 4-bromo-3-nitroaniline |
| InChIKey | PITHQPMZWKZGRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)