Products 53344-72-2
CAS 53344-72-2 appears in our catalog under these names: 6，6'–Dichloro–2，2'–bipyridine, 6,6'-Dichloro-2,2'-bipyridine 97%, 6,6'-Dichloro-2,2'-bipyridine, 97%, 97%, 6,6'-Dichloro-2,2'-bipyridine, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
2-chloro-6-(6-chloro-2-pyridinyl)pyridine (CAS 53344-72-2) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 2-chloro-6-(6-chloro-2-pyridinyl)pyridine. InChIKey: WYCIUIOCIYSVOZ-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2-chloro-6-(6-chloro-2-pyridinyl)pyridine |
| InChIKey | WYCIUIOCIYSVOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)C2=NC(=CC=C2)Cl |
Computed by PubChem (NCBI)