CAS 53427-97-7 is the registry number for Apixaban Impurity 86. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-(4-nitrophenyl)pyridin-2-one (CAS 53427-97-7) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 1-(4-nitrophenyl)pyridin-2-one. InChIKey: GHNIJTDEWVCPBV-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 1-(4-nitrophenyl)pyridin-2-one |
| InChIKey | GHNIJTDEWVCPBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)