CAS 5350-57-2 appears in our catalog under these names: Diphenylmethanone Hydrazone, Benzophenone hydrazone, Benzophenone hydrazone, 98+% , Benzophenone hydrazone, Benzophenone hydrazone, 98+%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 100g, 10g, 25g, 500g, 1000g, 50g, 250g, 5000g.
Benzhydrylidenehydrazine (CAS 5350-57-2) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: benzhydrylidenehydrazine. InChIKey: QYCSNMDOZNUZIT-UHFFFAOYSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | benzhydrylidenehydrazine |
| InChIKey | QYCSNMDOZNUZIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)