CAS 53658-17-6 is the registry number for 2-(1,2-Oxazole-4-carbonyl)phenol. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(2-hydroxyphenyl)-(1,2-oxazol-4-yl)methanone (CAS 53658-17-6) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: (2-hydroxyphenyl)-(1,2-oxazol-4-yl)methanone. InChIKey: MIBFNKDFHJNSAK-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | (2-hydroxyphenyl)-(1,2-oxazol-4-yl)methanone |
| InChIKey | MIBFNKDFHJNSAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CON=C2)O |
Computed by PubChem (NCBI)