Products 53734-75-1
CAS 53734-75-1 is the registry number for Neorauflavene. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
4-(5-methoxy-2,2-dimethyl-8H-pyrano[3,2-g]chromen-7-yl)benzene-1,3-diol (CAS 53734-75-1) is a chemical compound with the molecular formula C21H20O5 and a molecular weight of 352.4 g/mol. IUPAC name: 4-(5-methoxy-2,2-dimethyl-8H-pyrano[3,2-g]chromen-7-yl)benzene-1,3-diol. InChIKey: LDZFETFUTCHVSH-UHFFFAOYSA-N.
| Molecular formula | C21H20O5 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 4-(5-methoxy-2,2-dimethyl-8H-pyrano[3,2-g]chromen-7-yl)benzene-1,3-diol |
| InChIKey | LDZFETFUTCHVSH-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(C3=C(C=C2O1)OCC(=C3)C4=C(C=C(C=C4)O)O)OC)C |
Computed by PubChem (NCBI)