CAS 5378-33-6 appears in our catalog under these names: 2-(3-chlorophenyl)-1,3,4-oxadiazole, 95%, 2-(3-Chlorophenyl)-1,3,4-oxadiazole, 95+%, 2-(3-Chlorophenyl)-1,3,4-oxadiazole, 2-(3-Chlorophenyl)-1,3,4-oxadiazole, ≥95%, ≥95%, 2-(3-Chlorophenyl)-1,3,4-oxadiazole, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
2-(3-chlorophenyl)-1,3,4-oxadiazole (CAS 5378-33-6) is a chemical compound with the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,3,4-oxadiazole. InChIKey: PPPRLXXCIJKANA-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,3,4-oxadiazole |
| InChIKey | PPPRLXXCIJKANA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NN=CO2 |
Computed by PubChem (NCBI)