Products 53863-67-5
CAS 53863-67-5 is the registry number for 6-amino-5-hydroxy-tetralin-1-one, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-amino-5-hydroxy-3,4-dihydro-2H-naphthalen-1-one (CAS 53863-67-5) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 6-amino-5-hydroxy-3,4-dihydro-2H-naphthalen-1-one. InChIKey: XAOUIBYCTKSWMJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 6-amino-5-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | XAOUIBYCTKSWMJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2O)N)C(=O)C1 |
Computed by PubChem (NCBI)