CAS 5392-10-9 appears in our catalog under these names: 6-Bromoveratraldehyde/ 97%, 6-Bromoveratraldehyde, 97% , 6-Bromoveratraldehyde, 2-Bromo-4,5-dimethoxybenzaldehyde, >98.0%(GC), 2-Bromo-4,5-dimethoxybenzaldehyde 98%. Offered by: Chemat, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 10g, 2g, 50g, 5g, 25g, 100g, 250g, 500g.
2-bromo-4,5-dimethoxybenzaldehyde (CAS 5392-10-9) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-4,5-dimethoxybenzaldehyde. InChIKey: UQQROBHFUDBOOK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-bromo-4,5-dimethoxybenzaldehyde |
| InChIKey | UQQROBHFUDBOOK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)Br)OC |
Computed by PubChem (NCBI)