CAS 53944-29-9 is the registry number for Pranoprofen Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5H-chromeno[2,3-b]pyridin-7-yl)ethanone (CAS 53944-29-9) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 1-(5H-chromeno[2,3-b]pyridin-7-yl)ethanone. InChIKey: NYNGSJYRIZPXBX-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 1-(5H-chromeno[2,3-b]pyridin-7-yl)ethanone |
| InChIKey | NYNGSJYRIZPXBX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)OC3=C(C2)C=CC=N3 |
Computed by PubChem (NCBI)